C15H12N2S2 — CID 177474050
2-(4-methylsulfanylphenyl)-4-pyridin-2-yl-1,3-thiazole (PubChem CID 177474050) has the molecular formula C15H12N2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-(4-methylsulfanylphenyl)-4-pyridin-2-yl-1,3-thiazole.
| Compound Name | 2-(4-methylsulfanylphenyl)-4-pyridin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 177474050 |
| Molecular Formula | C15H12N2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-(4-methylsulfanylphenyl)-4-pyridin-2-yl-1,3-thiazole |
| SMILES | CSc1ccc(-c2nc(-c3ccccn3)cs2)cc1 |
| InChI | InChI=1S/C15H12N2S2/c1-18-12-7-5-11(6-8-12)15-17-14(10-19-15)13-4-2-3-9-16-13/h2-10H,1H3 |
| InChIKey | BMNSSGKFCXFXCW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |