C13H13NS2 — CID 134966043
2-[2,4-bis(methylsulfanyl)phenyl]pyridine (PubChem CID 134966043) has the molecular formula C13H13NS2 and a molecular weight of 247.39 g/mol. Its IUPAC name is 2-[2,4-bis(methylsulfanyl)phenyl]pyridine.
| Compound Name | 2-[2,4-bis(methylsulfanyl)phenyl]pyridine |
|---|---|
| PubChem CID | 134966043 |
| Molecular Formula | C13H13NS2 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-[2,4-bis(methylsulfanyl)phenyl]pyridine |
| SMILES | CSc1ccc(-c2ccccn2)c(SC)c1 |
| InChI | InChI=1S/C13H13NS2/c1-15-10-6-7-11(13(9-10)16-2)12-5-3-4-8-14-12/h3-9H,1-2H3 |
| InChIKey | LORJSDNKNSLECX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |