C13H11NO2S — CID 135001402
2-(6-methylsulfanyl-1,3-benzodioxol-5-yl)pyridine (PubChem CID 135001402) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-(6-methylsulfanyl-1,3-benzodioxol-5-yl)pyridine.
| Compound Name | 2-(6-methylsulfanyl-1,3-benzodioxol-5-yl)pyridine |
|---|---|
| PubChem CID | 135001402 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-(6-methylsulfanyl-1,3-benzodioxol-5-yl)pyridine |
| SMILES | CSc1cc2c(cc1-c1ccccn1)OCO2 |
| InChI | InChI=1S/C13H11NO2S/c1-17-13-7-12-11(15-8-16-12)6-9(13)10-4-2-3-5-14-10/h2-7H,8H2,1H3 |
| InChIKey | MRCMIVWRZJCKOX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |