C9H10O3S — CID 123594562
5-methoxy-6-methylsulfanyl-1,3-benzodioxole (PubChem CID 123594562) has the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. Its IUPAC name is 5-methoxy-6-methylsulfanyl-1,3-benzodioxole.
| Compound Name | 5-methoxy-6-methylsulfanyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 123594562 |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 5-methoxy-6-methylsulfanyl-1,3-benzodioxole |
| SMILES | COc1cc2c(cc1SC)OCO2 |
| InChI | InChI=1S/C9H10O3S/c1-10-8-3-6-7(12-5-11-6)4-9(8)13-2/h3-4H,5H2,1-2H3 |
| InChIKey | NMHHFHHLXWVZCZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |