C24H22OS — CID 157140153
1,1'-biphenyl;2-methoxy-3-methylsulfanylnaphthalene (PubChem CID 157140153) has the molecular formula C24H22OS and a molecular weight of 358.51 g/mol. Its IUPAC name is 1,1'-biphenyl;2-methoxy-3-methylsulfanylnaphthalene.
| Compound Name | 1,1'-biphenyl;2-methoxy-3-methylsulfanylnaphthalene |
|---|---|
| PubChem CID | 157140153 |
| Molecular Formula | C24H22OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1,1'-biphenyl;2-methoxy-3-methylsulfanylnaphthalene |
| SMILES | COc1cc2ccccc2cc1SC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H12OS.C12H10/c1-13-11-7-9-5-3-4-6-10(9)8-12(11)14-2;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h3-8H,1-2H3;1-10H |
| InChIKey | AKCFNXWSJXYPEB-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |