About CID 90433687
CID 90433687 (PubChem CID 90433687) has the molecular formula C11H9BO
and a molecular weight of 168.00 g/mol.
Molecular Properties
| Compound Name | CID 90433687 |
| PubChem CID | 90433687 |
| Molecular Formula | C11H9BO |
| Molecular Weight | 168.00 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | — |
| SMILES | [B]c1cc2ccccc2cc1OC |
| InChI | InChI=1S/C11H9BO/c1-13-11-7-9-5-3-2-4-8(9)6-10(11)12/h2-7H,1H3 |
| InChIKey | OUCFSFPRNHGIOK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.00 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90433687 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90433687?
The IUPAC name of CID 90433687 (CID 90433687) is not available.
What is the SMILES notation for CID 90433687?
The canonical SMILES for CID 90433687 is [B]c1cc2ccccc2cc1OC.
What is the InChIKey of CID 90433687?
The InChIKey is OUCFSFPRNHGIOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BO/c1-13-11-7-9-5-3-2-4-8(9)6-10(11)12/h2-7H,1H3.
What are the key properties of CID 90433687?
CID 90433687 has a molecular weight of 168.00 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90433687 is sourced from PubChem (CID 90433687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).