C40H34O6 — CID 141153743
6,13-bis(2,4,6-trimethoxyphenyl)pentacene (PubChem CID 141153743) has the molecular formula C40H34O6 and a molecular weight of 610.71 g/mol. Its IUPAC name is 6,13-bis(2,4,6-trimethoxyphenyl)pentacene.
| Compound Name | 6,13-bis(2,4,6-trimethoxyphenyl)pentacene |
|---|---|
| PubChem CID | 141153743 |
| Molecular Formula | C40H34O6 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | 6,13-bis(2,4,6-trimethoxyphenyl)pentacene |
| SMILES | COc1cc(OC)c(-c2c3cc4ccccc4cc3c(-c3c(OC)cc(OC)cc3OC)c3cc4ccccc4cc23)c(OC)c1 |
| InChI | InChI=1S/C40H34O6/c1-41-27-19-33(43-3)39(34(20-27)44-4)37-29-15-23-11-7-9-13-25(23)17-31(29)38(32-18-26-14-10-8-12-24(26)16-30(32)37)40-35(45-5)21-28(42-2)22-36(40)46-6/h7-22H,1-6H3 |
| InChIKey | QJSPBPAKXRFBFX-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|