C13H15NO3 — CID 135036019
2-(2,4,6-trimethoxyphenyl)-1H-pyrrole (PubChem CID 135036019) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(2,4,6-trimethoxyphenyl)-1H-pyrrole.
| Compound Name | 2-(2,4,6-trimethoxyphenyl)-1H-pyrrole |
|---|---|
| PubChem CID | 135036019 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-(2,4,6-trimethoxyphenyl)-1H-pyrrole |
| SMILES | COc1cc(OC)c(-c2ccc[nH]2)c(OC)c1 |
| InChI | InChI=1S/C13H15NO3/c1-15-9-7-11(16-2)13(12(8-9)17-3)10-5-4-6-14-10/h4-8,14H,1-3H3 |
| InChIKey | MNHRSSQOKZEIMY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |