C15H11F5O3 — CID 102431568
1,2,3,4,5-pentafluoro-6-(2,4,6-trimethoxyphenyl)benzene (PubChem CID 102431568) has the molecular formula C15H11F5O3 and a molecular weight of 334.24 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(2,4,6-trimethoxyphenyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(2,4,6-trimethoxyphenyl)benzene |
|---|---|
| PubChem CID | 102431568 |
| Molecular Formula | C15H11F5O3 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(2,4,6-trimethoxyphenyl)benzene |
| SMILES | COc1cc(OC)c(-c2c(F)c(F)c(F)c(F)c2F)c(OC)c1 |
| InChI | InChI=1S/C15H11F5O3/c1-21-6-4-7(22-2)9(8(5-6)23-3)10-11(16)13(18)15(20)14(19)12(10)17/h4-5H,1-3H3 |
| InChIKey | ZOFMGBKRKSPUAW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|