C10H13FO3 — CID 117289259
1-(2-fluoro-3,5-dimethoxyphenyl)ethanol (PubChem CID 117289259) has the molecular formula C10H13FO3 and a molecular weight of 200.21 g/mol. Its IUPAC name is 1-(2-fluoro-3,5-dimethoxyphenyl)ethanol.
| Compound Name | 1-(2-fluoro-3,5-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 117289259 |
| Molecular Formula | C10H13FO3 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1-(2-fluoro-3,5-dimethoxyphenyl)ethanol |
| SMILES | COc1cc(OC)c(F)c(C(C)O)c1 |
| InChI | InChI=1S/C10H13FO3/c1-6(12)8-4-7(13-2)5-9(14-3)10(8)11/h4-6,12H,1-3H3 |
| InChIKey | OVPFFCRUQGQDGW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |