C9H11FO3 — CID 151392889
1-fluoro-2,3,5-trimethoxybenzene (PubChem CID 151392889) has the molecular formula C9H11FO3 and a molecular weight of 186.18 g/mol. Its IUPAC name is 1-fluoro-2,3,5-trimethoxybenzene.
| Compound Name | 1-fluoro-2,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 151392889 |
| Molecular Formula | C9H11FO3 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 1-fluoro-2,3,5-trimethoxybenzene |
| SMILES | COc1cc(F)c(OC)c(OC)c1 |
| InChI | InChI=1S/C9H11FO3/c1-11-6-4-7(10)9(13-3)8(5-6)12-2/h4-5H,1-3H3 |
| InChIKey | OUUXGWJESZIAAB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |