C17H17NO4 — CID 175793272
1,3,6,8-tetramethoxyacridine (PubChem CID 175793272) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1,3,6,8-tetramethoxyacridine.
| Compound Name | 1,3,6,8-tetramethoxyacridine |
|---|---|
| PubChem CID | 175793272 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1,3,6,8-tetramethoxyacridine |
| SMILES | COc1cc(OC)c2cc3c(OC)cc(OC)cc3nc2c1 |
| InChI | InChI=1S/C17H17NO4/c1-19-10-5-14-12(16(7-10)21-3)9-13-15(18-14)6-11(20-2)8-17(13)22-4/h5-9H,1-4H3 |
| InChIKey | RGWWIRKNSFTRNF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|