C27H33ClO9Si — CID 88962916
chloro-tris(2,4,6-trimethoxyphenyl)silane (PubChem CID 88962916) has the molecular formula C27H33ClO9Si and a molecular weight of 565.09 g/mol. Its IUPAC name is chloro-tris(2,4,6-trimethoxyphenyl)silane.
| Compound Name | chloro-tris(2,4,6-trimethoxyphenyl)silane |
|---|---|
| PubChem CID | 88962916 |
| Molecular Formula | C27H33ClO9Si |
| Molecular Weight | 565.09 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | chloro-tris(2,4,6-trimethoxyphenyl)silane |
| SMILES | COc1cc(OC)c([Si](Cl)(c2c(OC)cc(OC)cc2OC)c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C27H33ClO9Si/c1-29-16-10-19(32-4)25(20(11-16)33-5)38(28,26-21(34-6)12-17(30-2)13-22(26)35-7)27-23(36-8)14-18(31-3)15-24(27)37-9/h10-15H,1-9H3 |
| InChIKey | UBROWRRQXPGYIO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.09 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|