C10H13IO3 — CID 10946751
2-(iodomethyl)-1,3,5-trimethoxybenzene (PubChem CID 10946751) has the molecular formula C10H13IO3 and a molecular weight of 308.12 g/mol. Its IUPAC name is 2-(iodomethyl)-1,3,5-trimethoxybenzene.
| Compound Name | 2-(iodomethyl)-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 10946751 |
| Molecular Formula | C10H13IO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 2-(iodomethyl)-1,3,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(CI)c(OC)c1 |
| InChI | InChI=1S/C10H13IO3/c1-12-7-4-9(13-2)8(6-11)10(5-7)14-3/h4-5H,6H2,1-3H3 |
| InChIKey | CWIXGPXQLQNPHM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|