C11H17NO2 — CID 141261453
3,5-dimethoxy-2-propylaniline (PubChem CID 141261453) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3,5-dimethoxy-2-propylaniline.
| Compound Name | 3,5-dimethoxy-2-propylaniline |
|---|---|
| PubChem CID | 141261453 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3,5-dimethoxy-2-propylaniline |
| SMILES | CCCc1c(N)cc(OC)cc1OC |
| InChI | InChI=1S/C11H17NO2/c1-4-5-9-10(12)6-8(13-2)7-11(9)14-3/h6-7H,4-5,12H2,1-3H3 |
| InChIKey | NQSJXOZFOQYRQC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|