C14H21BrO3 — CID 56956628
2-(5-bromopentyl)-1,3,5-trimethoxybenzene (PubChem CID 56956628) has the molecular formula C14H21BrO3 and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-(5-bromopentyl)-1,3,5-trimethoxybenzene.
| Compound Name | 2-(5-bromopentyl)-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 56956628 |
| Molecular Formula | C14H21BrO3 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-(5-bromopentyl)-1,3,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(CCCCCBr)c(OC)c1 |
| InChI | InChI=1S/C14H21BrO3/c1-16-11-9-13(17-2)12(14(10-11)18-3)7-5-4-6-8-15/h9-10H,4-8H2,1-3H3 |
| InChIKey | RKJAPLOZWZLODQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|