C14H23NO3 — CID 115259613
N-ethyl-N-methyl-2-(2,4,6-trimethoxyphenyl)ethanamine (PubChem CID 115259613) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-(2,4,6-trimethoxyphenyl)ethanamine.
| Compound Name | N-ethyl-N-methyl-2-(2,4,6-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 115259613 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-ethyl-N-methyl-2-(2,4,6-trimethoxyphenyl)ethanamine |
| SMILES | CCN(C)CCc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C14H23NO3/c1-6-15(2)8-7-12-13(17-4)9-11(16-3)10-14(12)18-5/h9-10H,6-8H2,1-5H3 |
| InChIKey | UTOKBPKIUNXRKK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |