C13H23ClN2O2 — CID 18789881
2-[2-[ethyl(methyl)amino]ethyl]-4,5-dimethoxyaniline;hydrochloride (PubChem CID 18789881) has the molecular formula C13H23ClN2O2 and a molecular weight of 274.79 g/mol. Its IUPAC name is 2-[2-[ethyl(methyl)amino]ethyl]-4,5-dimethoxyaniline;hydrochloride.
| Compound Name | 2-[2-[ethyl(methyl)amino]ethyl]-4,5-dimethoxyaniline;hydrochloride |
|---|---|
| PubChem CID | 18789881 |
| Molecular Formula | C13H23ClN2O2 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-[2-[ethyl(methyl)amino]ethyl]-4,5-dimethoxyaniline;hydrochloride |
| SMILES | CCN(C)CCc1cc(OC)c(OC)cc1N.Cl |
| InChI | InChI=1S/C13H22N2O2.ClH/c1-5-15(2)7-6-10-8-12(16-3)13(17-4)9-11(10)14;/h8-9H,5-7,14H2,1-4H3;1H |
| InChIKey | WQQZADMUFYZDOY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|