C11H18N2O2 — CID 22439028
4,5-dimethoxy-2-[2-(methylamino)ethyl]aniline (PubChem CID 22439028) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[2-(methylamino)ethyl]aniline.
| Compound Name | 4,5-dimethoxy-2-[2-(methylamino)ethyl]aniline |
|---|---|
| PubChem CID | 22439028 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4,5-dimethoxy-2-[2-(methylamino)ethyl]aniline |
| SMILES | CNCCc1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C11H18N2O2/c1-13-5-4-8-6-10(14-2)11(15-3)7-9(8)12/h6-7,13H,4-5,12H2,1-3H3 |
| InChIKey | NUXHJYZTRCTDCM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|