C10H13F2NO2 — CID 117309032
2,6-difluoro-3-methoxy-5-[2-(methylamino)ethyl]phenol (PubChem CID 117309032) has the molecular formula C10H13F2NO2 and a molecular weight of 217.21 g/mol. Its IUPAC name is 2,6-difluoro-3-methoxy-5-[2-(methylamino)ethyl]phenol.
| Compound Name | 2,6-difluoro-3-methoxy-5-[2-(methylamino)ethyl]phenol |
|---|---|
| PubChem CID | 117309032 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2,6-difluoro-3-methoxy-5-[2-(methylamino)ethyl]phenol |
| SMILES | CNCCc1cc(OC)c(F)c(O)c1F |
| InChI | InChI=1S/C10H13F2NO2/c1-13-4-3-6-5-7(15-2)9(12)10(14)8(6)11/h5,13-14H,3-4H2,1-2H3 |
| InChIKey | GIOMOOQVMUAPTB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |