C9H15BrN2O2 — CID 90677984
4-amino-5-[2-(methylamino)ethyl]benzene-1,2-diol;hydrobromide (PubChem CID 90677984) has the molecular formula C9H15BrN2O2 and a molecular weight of 263.13 g/mol. Its IUPAC name is 4-amino-5-[2-(methylamino)ethyl]benzene-1,2-diol;hydrobromide.
| Compound Name | 4-amino-5-[2-(methylamino)ethyl]benzene-1,2-diol;hydrobromide |
|---|---|
| PubChem CID | 90677984 |
| Molecular Formula | C9H15BrN2O2 |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 4-amino-5-[2-(methylamino)ethyl]benzene-1,2-diol;hydrobromide |
| SMILES | Br.CNCCc1cc(O)c(O)cc1N |
| InChI | InChI=1S/C9H14N2O2.BrH/c1-11-3-2-6-4-8(12)9(13)5-7(6)10;/h4-5,11-13H,2-3,10H2,1H3;1H |
| InChIKey | CDKVVYQOYYARBJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|