C15H24N2O5 — CID 82071577
3-(2-amino-4,5-dimethoxyphenyl)-N,N-bis(2-hydroxyethyl)propanamide (PubChem CID 82071577) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(2-amino-4,5-dimethoxyphenyl)-N,N-bis(2-hydroxyethyl)propanamide.
| Compound Name | 3-(2-amino-4,5-dimethoxyphenyl)-N,N-bis(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 82071577 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 3-(2-amino-4,5-dimethoxyphenyl)-N,N-bis(2-hydroxyethyl)propanamide |
| SMILES | COc1cc(N)c(CCC(=O)N(CCO)CCO)cc1OC |
| InChI | InChI=1S/C15H24N2O5/c1-21-13-9-11(12(16)10-14(13)22-2)3-4-15(20)17(5-7-18)6-8-19/h9-10,18-19H,3-8,16H2,1-2H3 |
| InChIKey | LZHDOCSYPXBKHO-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|