C18H21NO4 — CID 125466047
(2R)-4-(2-amino-4,5-dimethoxyphenyl)-2-phenylbutanoic acid (PubChem CID 125466047) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (2R)-4-(2-amino-4,5-dimethoxyphenyl)-2-phenylbutanoic acid.
| Compound Name | (2R)-4-(2-amino-4,5-dimethoxyphenyl)-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 125466047 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (2R)-4-(2-amino-4,5-dimethoxyphenyl)-2-phenylbutanoic acid |
| SMILES | COc1cc(N)c(CC[C@@H](C(=O)O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H21NO4/c1-22-16-10-13(15(19)11-17(16)23-2)8-9-14(18(20)21)12-6-4-3-5-7-12/h3-7,10-11,14H,8-9,19H2,1-2H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | PDDWXUMETIQRIW-CQSZACIVSA-N |
| XLogP | 3.09 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|