C19H23NO4 — CID 175712395
2-phenyl-4-(3,4,5-trimethoxyphenyl)butanamide (PubChem CID 175712395) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-phenyl-4-(3,4,5-trimethoxyphenyl)butanamide.
| Compound Name | 2-phenyl-4-(3,4,5-trimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 175712395 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-phenyl-4-(3,4,5-trimethoxyphenyl)butanamide |
| SMILES | COc1cc(CCC(C(N)=O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H23NO4/c1-22-16-11-13(12-17(23-2)18(16)24-3)9-10-15(19(20)21)14-7-5-4-6-8-14/h4-8,11-12,15H,9-10H2,1-3H3,(H2,20,21) |
| InChIKey | UXIQBHGNQNYPRG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |