C21H29ClN2O4 — CID 19046560
4-(N-ethylanilino)-2-(3,4,5-trimethoxyphenyl)butanamide;hydrochloride (PubChem CID 19046560) has the molecular formula C21H29ClN2O4 and a molecular weight of 408.93 g/mol. Its IUPAC name is 4-(N-ethylanilino)-2-(3,4,5-trimethoxyphenyl)butanamide;hydrochloride.
| Compound Name | 4-(N-ethylanilino)-2-(3,4,5-trimethoxyphenyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 19046560 |
| Molecular Formula | C21H29ClN2O4 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 4-(N-ethylanilino)-2-(3,4,5-trimethoxyphenyl)butanamide;hydrochloride |
| SMILES | CCN(CCC(C(N)=O)c1cc(OC)c(OC)c(OC)c1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H28N2O4.ClH/c1-5-23(16-9-7-6-8-10-16)12-11-17(21(22)24)15-13-18(25-2)20(27-4)19(14-15)26-3;/h6-10,13-14,17H,5,11-12H2,1-4H3,(H2,22,24);1H |
| InChIKey | NZJGHZVDGYDWPI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |