C19H22O5Se — CID 11395726
ethyl 2-phenylselanyl-2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 11395726) has the molecular formula C19H22O5Se and a molecular weight of 409.34 g/mol. Its IUPAC name is ethyl 2-phenylselanyl-2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | ethyl 2-phenylselanyl-2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 11395726 |
| Molecular Formula | C19H22O5Se |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | ethyl 2-phenylselanyl-2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | CCOC(=O)C([Se]c1ccccc1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H22O5Se/c1-5-24-19(20)18(25-14-9-7-6-8-10-14)13-11-15(21-2)17(23-4)16(12-13)22-3/h6-12,18H,5H2,1-4H3 |
| InChIKey | ZSQHSNRKASWGIK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|