C26H26O5 — CID 2731026
1,5-diphenyl-3-(3,4,5-trimethoxyphenyl)pentane-1,5-dione (PubChem CID 2731026) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1,5-diphenyl-3-(3,4,5-trimethoxyphenyl)pentane-1,5-dione.
| Compound Name | 1,5-diphenyl-3-(3,4,5-trimethoxyphenyl)pentane-1,5-dione |
|---|---|
| PubChem CID | 2731026 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1,5-diphenyl-3-(3,4,5-trimethoxyphenyl)pentane-1,5-dione |
| SMILES | COc1cc(C(CC(=O)c2ccccc2)CC(=O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H26O5/c1-29-24-16-21(17-25(30-2)26(24)31-3)20(14-22(27)18-10-6-4-7-11-18)15-23(28)19-12-8-5-9-13-19/h4-13,16-17,20H,14-15H2,1-3H3 |
| InChIKey | DXWLPAIRHYYWIF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |