C21H26ClNO5 — CID 67699495
6-oxo-4-phenyl-6-(3,4,5-trimethoxyphenyl)hexanamide;hydrochloride (PubChem CID 67699495) has the molecular formula C21H26ClNO5 and a molecular weight of 407.89 g/mol. Its IUPAC name is 6-oxo-4-phenyl-6-(3,4,5-trimethoxyphenyl)hexanamide;hydrochloride.
| Compound Name | 6-oxo-4-phenyl-6-(3,4,5-trimethoxyphenyl)hexanamide;hydrochloride |
|---|---|
| PubChem CID | 67699495 |
| Molecular Formula | C21H26ClNO5 |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 6-oxo-4-phenyl-6-(3,4,5-trimethoxyphenyl)hexanamide;hydrochloride |
| SMILES | COc1cc(C(=O)CC(CCC(N)=O)c2ccccc2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C21H25NO5.ClH/c1-25-18-12-16(13-19(26-2)21(18)27-3)17(23)11-15(9-10-20(22)24)14-7-5-4-6-8-14;/h4-8,12-13,15H,9-11H2,1-3H3,(H2,22,24);1H |
| InChIKey | VPCIXCTZVOVQCG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |