C19H26Cl2N2O4 — CID 67619593
3-amino-4-(4-aminophenyl)-1-(3,4,5-trimethoxyphenyl)butan-1-one;dihydrochloride (PubChem CID 67619593) has the molecular formula C19H26Cl2N2O4 and a molecular weight of 417.33 g/mol. Its IUPAC name is 3-amino-4-(4-aminophenyl)-1-(3,4,5-trimethoxyphenyl)butan-1-one;dihydrochloride.
| Compound Name | 3-amino-4-(4-aminophenyl)-1-(3,4,5-trimethoxyphenyl)butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 67619593 |
| Molecular Formula | C19H26Cl2N2O4 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-amino-4-(4-aminophenyl)-1-(3,4,5-trimethoxyphenyl)butan-1-one;dihydrochloride |
| SMILES | COc1cc(C(=O)CC(N)Cc2ccc(N)cc2)cc(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C19H24N2O4.2ClH/c1-23-17-9-13(10-18(24-2)19(17)25-3)16(22)11-15(21)8-12-4-6-14(20)7-5-12;;/h4-7,9-10,15H,8,11,20-21H2,1-3H3;2*1H |
| InChIKey | XCZASTSRRQFBTJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|