C16H19NO4 — CID 19626867
4-[(3,4,5-trimethoxyphenyl)methoxy]aniline (PubChem CID 19626867) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-[(3,4,5-trimethoxyphenyl)methoxy]aniline.
| Compound Name | 4-[(3,4,5-trimethoxyphenyl)methoxy]aniline |
|---|---|
| PubChem CID | 19626867 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-[(3,4,5-trimethoxyphenyl)methoxy]aniline |
| SMILES | COc1cc(COc2ccc(N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C16H19NO4/c1-18-14-8-11(9-15(19-2)16(14)20-3)10-21-13-6-4-12(17)5-7-13/h4-9H,10,17H2,1-3H3 |
| InChIKey | NOSYDQVSMNXWBR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|