(3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate

C18H19BrO6 — CID 9095645

IUPAC(3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate
SMILESCOc1cc(COC(=O)COc2ccc(Br)cc2)cc(OC)c1OC
InChIInChI=1S/C18H19BrO6/c1-21-15-8-12(9-16(22-2)18(15)23-3)10-25-17(20)11-24-14-6-4-13(19)5-7-14/h4-9H,10-11H2,1-3H3
InChIKeyVFTQBCCAVNYRBH-UHFFFAOYSA-N
MW411.25 g/mol
LogP3.60
Rot. Bonds8

About (3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate

(3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate (PubChem CID 9095645) has the molecular formula C18H19BrO6 and a molecular weight of 411.25 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate.

Molecular Properties

Compound Name(3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate
PubChem CID9095645
Molecular FormulaC18H19BrO6
Molecular Weight411.25 g/mol
Exact Mass410.04
IUPAC Name(3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate
SMILESCOc1cc(COC(=O)COc2ccc(Br)cc2)cc(OC)c1OC
InChIInChI=1S/C18H19BrO6/c1-21-15-8-12(9-16(22-2)18(15)23-3)10-25-17(20)11-24-14-6-4-13(19)5-7-14/h4-9H,10-11H2,1-3H3
InChIKeyVFTQBCCAVNYRBH-UHFFFAOYSA-N
XLogP3.60
TPSA63.22 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500411.25
LogP ≤ 53.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze (3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate?
The IUPAC name of (3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate (CID 9095645) is (3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate.
What is the SMILES notation for (3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate?
The canonical SMILES for (3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate is COc1cc(COC(=O)COc2ccc(Br)cc2)cc(OC)c1OC.
What is the InChIKey of (3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate?
The InChIKey is VFTQBCCAVNYRBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrO6/c1-21-15-8-12(9-16(22-2)18(15)23-3)10-25-17(20)11-24-14-6-4-13(19)5-7-14/h4-9H,10-11H2,1-3H3.
What are the key properties of (3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate?
(3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate has a molecular weight of 411.25 g/mol, XLogP of 3.60, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,5-trimethoxyphenyl)methyl 2-(4-bromophenoxy)acetate is sourced from PubChem (CID 9095645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).