C19H22O7 — CID 18275421
(3,4,5-trimethoxyphenyl)methyl 2-(2-methoxyphenoxy)acetate (PubChem CID 18275421) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)methyl 2-(2-methoxyphenoxy)acetate.
| Compound Name | (3,4,5-trimethoxyphenyl)methyl 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 18275421 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)methyl 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)OCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H22O7/c1-21-14-7-5-6-8-15(14)25-12-18(20)26-11-13-9-16(22-2)19(24-4)17(10-13)23-3/h5-10H,11-12H2,1-4H3 |
| InChIKey | CHBBPFCLIXQLKJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |