C20H24O6 — CID 8013844
(2-ethoxyphenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 8013844) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | (2-ethoxyphenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 8013844 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2-ethoxyphenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | CCOc1ccccc1COC(=O)Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H24O6/c1-5-25-16-9-7-6-8-15(16)13-26-19(21)12-14-10-17(22-2)20(24-4)18(11-14)23-3/h6-11H,5,12-13H2,1-4H3 |
| InChIKey | ZSIKZPVMJIXHNV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |