(2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate

C17H18O4 — CID 78760060

IUPAC(2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate
SMILESCOc1ccc(CC(=O)OCc2ccccc2OC)cc1
InChIInChI=1S/C17H18O4/c1-19-15-9-7-13(8-10-15)11-17(18)21-12-14-5-3-4-6-16(14)20-2/h3-10H,11-12H2,1-2H3
InChIKeyOXLMWMZYBVDYJY-UHFFFAOYSA-N
MW286.33 g/mol
LogP2.99
Rot. Bonds6

About (2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate

(2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate (PubChem CID 78760060) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate.

Molecular Properties

Compound Name(2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate
PubChem CID78760060
Molecular FormulaC17H18O4
Molecular Weight286.33 g/mol
Exact Mass286.12
IUPAC Name(2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate
SMILESCOc1ccc(CC(=O)OCc2ccccc2OC)cc1
InChIInChI=1S/C17H18O4/c1-19-15-9-7-13(8-10-15)11-17(18)21-12-14-5-3-4-6-16(14)20-2/h3-10H,11-12H2,1-2H3
InChIKeyOXLMWMZYBVDYJY-UHFFFAOYSA-N
XLogP2.99
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.33
LogP ≤ 52.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate?
The IUPAC name of (2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate (CID 78760060) is (2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate.
What is the SMILES notation for (2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate?
The canonical SMILES for (2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate is COc1ccc(CC(=O)OCc2ccccc2OC)cc1.
What is the InChIKey of (2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate?
The InChIKey is OXLMWMZYBVDYJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O4/c1-19-15-9-7-13(8-10-15)11-17(18)21-12-14-5-3-4-6-16(14)20-2/h3-10H,11-12H2,1-2H3.
What are the key properties of (2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate?
(2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate has a molecular weight of 286.33 g/mol, XLogP of 2.99, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyphenyl)methyl 2-(4-methoxyphenyl)acetate is sourced from PubChem (CID 78760060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).