C17H15NO4 — CID 25498133
1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate (PubChem CID 25498133) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 25498133 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-20-13-8-6-12(7-9-13)10-17(19)21-11-16-18-14-4-2-3-5-15(14)22-16/h2-9H,10-11H2,1H3 |
| InChIKey | AOPOUXQLAYQIFQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |