1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate

C17H15NO4 — CID 25498133

IUPAC1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate
SMILESCOc1ccc(CC(=O)OCc2nc3ccccc3o2)cc1
InChIInChI=1S/C17H15NO4/c1-20-13-8-6-12(7-9-13)10-17(19)21-11-16-18-14-4-2-3-5-15(14)22-16/h2-9H,10-11H2,1H3
InChIKeyAOPOUXQLAYQIFQ-UHFFFAOYSA-N
MW297.31 g/mol
LogP3.12
Rot. Bonds5

About 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate

1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate (PubChem CID 25498133) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate.

Molecular Properties

Compound Name1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate
PubChem CID25498133
Molecular FormulaC17H15NO4
Molecular Weight297.31 g/mol
Exact Mass297.10
IUPAC Name1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate
SMILESCOc1ccc(CC(=O)OCc2nc3ccccc3o2)cc1
InChIInChI=1S/C17H15NO4/c1-20-13-8-6-12(7-9-13)10-17(19)21-11-16-18-14-4-2-3-5-15(14)22-16/h2-9H,10-11H2,1H3
InChIKeyAOPOUXQLAYQIFQ-UHFFFAOYSA-N
XLogP3.12
TPSA61.56 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.31
LogP ≤ 53.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate?
The IUPAC name of 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate (CID 25498133) is 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate.
What is the SMILES notation for 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate?
The canonical SMILES for 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate is COc1ccc(CC(=O)OCc2nc3ccccc3o2)cc1.
What is the InChIKey of 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate?
The InChIKey is AOPOUXQLAYQIFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO4/c1-20-13-8-6-12(7-9-13)10-17(19)21-11-16-18-14-4-2-3-5-15(14)22-16/h2-9H,10-11H2,1H3.
What are the key properties of 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate?
1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate has a molecular weight of 297.31 g/mol, XLogP of 3.12, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzoxazol-2-ylmethyl 2-(4-methoxyphenyl)acetate is sourced from PubChem (CID 25498133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).