About (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate
(2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate (PubChem CID 22418608) has the molecular formula C22H26O6S2
and a molecular weight of 450.58 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate.
Molecular Properties
| Compound Name | (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate |
| PubChem CID | 22418608 |
| Molecular Formula | C22H26O6S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate |
| SMILES | COc1ccccc1COC(=O)C(C)SSC(C)C(=O)OCc1ccccc1OC |
| InChI | InChI=1S/C22H26O6S2/c1-15(21(23)27-13-17-9-5-7-11-19(17)25-3)29-30-16(2)22(24)28-14-18-10-6-8-12-20(18)26-4/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | NLDGZAGMTAMMMS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate?
The IUPAC name of (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate (CID 22418608) is (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate.
What is the SMILES notation for (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate?
The canonical SMILES for (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate is COc1ccccc1COC(=O)C(C)SSC(C)C(=O)OCc1ccccc1OC.
What is the InChIKey of (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate?
The InChIKey is NLDGZAGMTAMMMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O6S2/c1-15(21(23)27-13-17-9-5-7-11-19(17)25-3)29-30-16(2)22(24)28-14-18-10-6-8-12-20(18)26-4/h5-12,15-16H,13-14H2,1-4H3.
What are the key properties of (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate?
(2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate has a molecular weight of 450.58 g/mol, XLogP of 4.65, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyphenyl)methyl 2-[[1-[(2-methoxyphenyl)methoxy]-1-oxopropan-2-yl]disulfanyl]propanoate is sourced from PubChem (CID 22418608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).