C11H13NO5 — CID 95454152
2-[(2-methoxyphenyl)methoxycarbonylamino]acetic acid (PubChem CID 95454152) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methoxycarbonylamino]acetic acid.
| Compound Name | 2-[(2-methoxyphenyl)methoxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 95454152 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-[(2-methoxyphenyl)methoxycarbonylamino]acetic acid |
| SMILES | COc1ccccc1COC(=O)NCC(=O)O |
| InChI | InChI=1S/C11H13NO5/c1-16-9-5-3-2-4-8(9)7-17-11(15)12-6-10(13)14/h2-5H,6-7H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | OSXSTDIBNKSXPX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |