C14H18O3 — CID 78760103
(2-methoxyphenyl)methyl cyclopentanecarboxylate (PubChem CID 78760103) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl cyclopentanecarboxylate.
| Compound Name | (2-methoxyphenyl)methyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 78760103 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (2-methoxyphenyl)methyl cyclopentanecarboxylate |
| SMILES | COc1ccccc1COC(=O)C1CCCC1 |
| InChI | InChI=1S/C14H18O3/c1-16-13-9-5-4-8-12(13)10-17-14(15)11-6-2-3-7-11/h4-5,8-9,11H,2-3,6-7,10H2,1H3 |
| InChIKey | XBXFNVAGFKNMOS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |