C15H18O4 — CID 172567319
2-[2-(cyclohexanecarbonyloxy)phenyl]acetic acid (PubChem CID 172567319) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[2-(cyclohexanecarbonyloxy)phenyl]acetic acid.
| Compound Name | 2-[2-(cyclohexanecarbonyloxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 172567319 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-[2-(cyclohexanecarbonyloxy)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C15H18O4/c16-14(17)10-12-8-4-5-9-13(12)19-15(18)11-6-2-1-3-7-11/h4-5,8-9,11H,1-3,6-7,10H2,(H,16,17) |
| InChIKey | RSGBCUKQGYLOJD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|