C16H17F2O7S- — CID 177295092
2-[[2-(cyclohexanecarbonyloxy)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 177295092) has the molecular formula C16H17F2O7S- and a molecular weight of 391.37 g/mol. Its IUPAC name is 2-[[2-(cyclohexanecarbonyloxy)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[[2-(cyclohexanecarbonyloxy)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 177295092 |
| Molecular Formula | C16H17F2O7S- |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-[[2-(cyclohexanecarbonyloxy)phenyl]methoxy]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | O=C(Oc1ccccc1COC(=O)C(F)(F)S(=O)(=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C16H18F2O7S/c17-16(18,26(21,22)23)15(20)24-10-12-8-4-5-9-13(12)25-14(19)11-6-2-1-3-7-11/h4-5,8-9,11H,1-3,6-7,10H2,(H,21,22,23)/p-1 |
| InChIKey | XTAQKGOBXKVGBT-UHFFFAOYSA-M |
| XLogP | 2.35 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|