About (2-hydroxyphenyl) cyclopropanecarboxylate
(2-hydroxyphenyl) cyclopropanecarboxylate (PubChem CID 91694694) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is (2-hydroxyphenyl) cyclopropanecarboxylate.
Molecular Properties
| Compound Name | (2-hydroxyphenyl) cyclopropanecarboxylate |
| PubChem CID | 91694694 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (2-hydroxyphenyl) cyclopropanecarboxylate |
| SMILES | O=C(Oc1ccccc1O)C1CC1 |
| InChI | InChI=1S/C10H10O3/c11-8-3-1-2-4-9(8)13-10(12)7-5-6-7/h1-4,7,11H,5-6H2 |
| InChIKey | DGBNXXUVRXIURV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyphenyl) cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyphenyl) cyclopropanecarboxylate?
The IUPAC name of (2-hydroxyphenyl) cyclopropanecarboxylate (CID 91694694) is (2-hydroxyphenyl) cyclopropanecarboxylate.
What is the SMILES notation for (2-hydroxyphenyl) cyclopropanecarboxylate?
The canonical SMILES for (2-hydroxyphenyl) cyclopropanecarboxylate is O=C(Oc1ccccc1O)C1CC1.
What is the InChIKey of (2-hydroxyphenyl) cyclopropanecarboxylate?
The InChIKey is DGBNXXUVRXIURV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c11-8-3-1-2-4-9(8)13-10(12)7-5-6-7/h1-4,7,11H,5-6H2.
What are the key properties of (2-hydroxyphenyl) cyclopropanecarboxylate?
(2-hydroxyphenyl) cyclopropanecarboxylate has a molecular weight of 178.19 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyphenyl) cyclopropanecarboxylate is sourced from PubChem (CID 91694694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).