About pyridin-2-yl cyclopropanecarboxylate
pyridin-2-yl cyclopropanecarboxylate (PubChem CID 135376948) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is pyridin-2-yl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | pyridin-2-yl cyclopropanecarboxylate |
| PubChem CID | 135376948 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | pyridin-2-yl cyclopropanecarboxylate |
| SMILES | O=C(Oc1ccccn1)C1CC1 |
| InChI | InChI=1S/C9H9NO2/c11-9(7-4-5-7)12-8-3-1-2-6-10-8/h1-3,6-7H,4-5H2 |
| InChIKey | JYLUDQLOMYQOOJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridin-2-yl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl cyclopropanecarboxylate?
The IUPAC name of pyridin-2-yl cyclopropanecarboxylate (CID 135376948) is pyridin-2-yl cyclopropanecarboxylate.
What is the SMILES notation for pyridin-2-yl cyclopropanecarboxylate?
The canonical SMILES for pyridin-2-yl cyclopropanecarboxylate is O=C(Oc1ccccn1)C1CC1.
What is the InChIKey of pyridin-2-yl cyclopropanecarboxylate?
The InChIKey is JYLUDQLOMYQOOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c11-9(7-4-5-7)12-8-3-1-2-6-10-8/h1-3,6-7H,4-5H2.
What are the key properties of pyridin-2-yl cyclopropanecarboxylate?
pyridin-2-yl cyclopropanecarboxylate has a molecular weight of 163.18 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl cyclopropanecarboxylate is sourced from PubChem (CID 135376948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).