C19H16N2O4 — CID 67291878
dipyridin-2-yl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 67291878) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is dipyridin-2-yl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dipyridin-2-yl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 67291878 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | dipyridin-2-yl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | O=C(Oc1ccccn1)C1C2C=CC(C2)C1C(=O)Oc1ccccn1 |
| InChI | InChI=1S/C19H16N2O4/c22-18(24-14-5-1-3-9-20-14)16-12-7-8-13(11-12)17(16)19(23)25-15-6-2-4-10-21-15/h1-10,12-13,16-17H,11H2 |
| InChIKey | BICDWARHSWQXHX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|