C19H16ClNO — CID 102003803
[(1S,2S,3S,4R)-3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone (PubChem CID 102003803) has the molecular formula C19H16ClNO and a molecular weight of 309.80 g/mol. Its IUPAC name is [(1S,2S,3S,4R)-3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone.
| Compound Name | [(1S,2S,3S,4R)-3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 102003803 |
| Molecular Formula | C19H16ClNO |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | [(1S,2S,3S,4R)-3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)[C@@H]1[C@@H](c2ccc(Cl)cc2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C19H16ClNO/c20-15-8-6-12(7-9-15)17-13-4-5-14(11-13)18(17)19(22)16-3-1-2-10-21-16/h1-10,13-14,17-18H,11H2/t13-,14+,17-,18-/m0/s1 |
| InChIKey | CTVGBYQHXUZEGF-DACLVMHWSA-N |
| XLogP | 4.52 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|