C16H17ClO2 — CID 69020595
3-[3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]propanoic acid (PubChem CID 69020595) has the molecular formula C16H17ClO2 and a molecular weight of 276.76 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]propanoic acid.
| Compound Name | 3-[3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]propanoic acid |
|---|---|
| PubChem CID | 69020595 |
| Molecular Formula | C16H17ClO2 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-2-bicyclo[2.2.1]hept-5-enyl]propanoic acid |
| SMILES | O=C(O)CCC1C2C=CC(C2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClO2/c17-13-5-3-10(4-6-13)16-12-2-1-11(9-12)14(16)7-8-15(18)19/h1-6,11-12,14,16H,7-9H2,(H,18,19) |
| InChIKey | LWVPDHAOCBPIMY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|