C15H15BrO2 — CID 66898984
2-[3-(4-bromophenyl)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid (PubChem CID 66898984) has the molecular formula C15H15BrO2 and a molecular weight of 307.19 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid.
| Compound Name | 2-[3-(4-bromophenyl)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid |
|---|---|
| PubChem CID | 66898984 |
| Molecular Formula | C15H15BrO2 |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-[3-(4-bromophenyl)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid |
| SMILES | O=C(O)CC1C2C=CC(C2)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H15BrO2/c16-12-5-3-9(4-6-12)15-11-2-1-10(7-11)13(15)8-14(17)18/h1-6,10-11,13,15H,7-8H2,(H,17,18) |
| InChIKey | YRDBJWPSPYWPNT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|