C18H22O5 — CID 66899180
2-[3-(3,4,5-trimethoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid (PubChem CID 66899180) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-[3-(3,4,5-trimethoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid.
| Compound Name | 2-[3-(3,4,5-trimethoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid |
|---|---|
| PubChem CID | 66899180 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-[3-(3,4,5-trimethoxyphenyl)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid |
| SMILES | COc1cc(C2C3C=CC(C3)C2CC(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C18H22O5/c1-21-14-7-12(8-15(22-2)18(14)23-3)17-11-5-4-10(6-11)13(17)9-16(19)20/h4-5,7-8,10-11,13,17H,6,9H2,1-3H3,(H,19,20) |
| InChIKey | DQRVBRADVCJUIH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|