C26H32O10 — CID 122215201
dimethyl (1S,2S,3R,4R)-3,4-bis(3,4,5-trimethoxyphenyl)cyclobutane-1,2-dicarboxylate (PubChem CID 122215201) has the molecular formula C26H32O10 and a molecular weight of 504.53 g/mol. Its IUPAC name is dimethyl (1S,2S,3R,4R)-3,4-bis(3,4,5-trimethoxyphenyl)cyclobutane-1,2-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3R,4R)-3,4-bis(3,4,5-trimethoxyphenyl)cyclobutane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 122215201 |
| Molecular Formula | C26H32O10 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | dimethyl (1S,2S,3R,4R)-3,4-bis(3,4,5-trimethoxyphenyl)cyclobutane-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)[C@H](c2cc(OC)c(OC)c(OC)c2)[C@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C26H32O10/c1-29-15-9-13(10-16(30-2)23(15)33-5)19-20(22(26(28)36-8)21(19)25(27)35-7)14-11-17(31-3)24(34-6)18(12-14)32-4/h9-12,19-22H,1-8H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | XEZKFGAKNSPPAI-CZYKHXBRSA-N |
| XLogP | 3.20 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |