C16H20O7 — CID 119054760
ethyl 2-oxo-4-(3,4,5-trimethoxyphenyl)oxolane-3-carboxylate (PubChem CID 119054760) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is ethyl 2-oxo-4-(3,4,5-trimethoxyphenyl)oxolane-3-carboxylate.
| Compound Name | ethyl 2-oxo-4-(3,4,5-trimethoxyphenyl)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 119054760 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | ethyl 2-oxo-4-(3,4,5-trimethoxyphenyl)oxolane-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)OCC1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H20O7/c1-5-22-15(17)13-10(8-23-16(13)18)9-6-11(19-2)14(21-4)12(7-9)20-3/h6-7,10,13H,5,8H2,1-4H3 |
| InChIKey | MJFATMGGXKBQHS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|