C20H26O8 — CID 101161354
diethyl 4-methylidene-2-(3,4,5-trimethoxyphenyl)oxolane-3,3-dicarboxylate (PubChem CID 101161354) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is diethyl 4-methylidene-2-(3,4,5-trimethoxyphenyl)oxolane-3,3-dicarboxylate.
| Compound Name | diethyl 4-methylidene-2-(3,4,5-trimethoxyphenyl)oxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 101161354 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | diethyl 4-methylidene-2-(3,4,5-trimethoxyphenyl)oxolane-3,3-dicarboxylate |
| SMILES | C=C1COC(c2cc(OC)c(OC)c(OC)c2)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H26O8/c1-7-26-18(21)20(19(22)27-8-2)12(3)11-28-17(20)13-9-14(23-4)16(25-6)15(10-13)24-5/h9-10,17H,3,7-8,11H2,1-2,4-6H3 |
| InChIKey | AGJKMGRPYCUAEE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|